C13H18ClNO4 — CID 10613301
2-ethyl-1,3,3-trimethylindol-1-ium perchlorate (PubChem CID 10613301) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is 2-ethyl-1,3,3-trimethylindol-1-ium perchlorate.
| Compound Name | 2-ethyl-1,3,3-trimethylindol-1-ium perchlorate |
|---|---|
| PubChem CID | 10613301 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-ethyl-1,3,3-trimethylindol-1-ium perchlorate |
| SMILES | CCC1=[N+](C)c2ccccc2C1(C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C13H18N.ClHO4/c1-5-12-13(2,3)10-8-6-7-9-11(10)14(12)4;2-1(3,4)5/h6-9H,5H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | RNAZZSFDZILHGJ-UHFFFAOYSA-M |
| XLogP | -1.65 |
| TPSA | 95.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|