C15H21N2O+ — CID 3477511
4-(1,3,3-trimethylindol-1-ium-2-yl)butanamide (PubChem CID 3477511) has the molecular formula C15H21N2O+ and a molecular weight of 245.35 g/mol. Its IUPAC name is 4-(1,3,3-trimethylindol-1-ium-2-yl)butanamide.
| Compound Name | 4-(1,3,3-trimethylindol-1-ium-2-yl)butanamide |
|---|---|
| PubChem CID | 3477511 |
| Molecular Formula | C15H21N2O+ |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 4-(1,3,3-trimethylindol-1-ium-2-yl)butanamide |
| SMILES | C[N+]1=C(CCCC(N)=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C15H20N2O/c1-15(2)11-7-4-5-8-12(11)17(3)13(15)9-6-10-14(16)18/h4-5,7-8H,6,9-10H2,1-3H3,(H-,16,18)/p+1 |
| InChIKey | JIRPYUMJWNYGQX-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|