About hexanediamide;naphthalene
hexanediamide;naphthalene (PubChem CID 175366237) has the molecular formula C16H20N2O2
and a molecular weight of 272.35 g/mol. Its IUPAC name is hexanediamide;naphthalene.
Molecular Properties
| Compound Name | hexanediamide;naphthalene |
| PubChem CID | 175366237 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | hexanediamide;naphthalene |
| SMILES | NC(=O)CCCCC(N)=O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C6H12N2O2/c1-2-6-10-8-4-3-7-9(10)5-1;7-5(9)3-1-2-4-6(8)10/h1-8H;1-4H2,(H2,7,9)(H2,8,10) |
| InChIKey | CYBKJGIOEPGXSH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanediamide;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanediamide;naphthalene?
The IUPAC name of hexanediamide;naphthalene (CID 175366237) is hexanediamide;naphthalene.
What is the SMILES notation for hexanediamide;naphthalene?
The canonical SMILES for hexanediamide;naphthalene is NC(=O)CCCCC(N)=O.c1ccc2ccccc2c1.
What is the InChIKey of hexanediamide;naphthalene?
The InChIKey is CYBKJGIOEPGXSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C6H12N2O2/c1-2-6-10-8-4-3-7-9(10)5-1;7-5(9)3-1-2-4-6(8)10/h1-8H;1-4H2,(H2,7,9)(H2,8,10).
What are the key properties of hexanediamide;naphthalene?
hexanediamide;naphthalene has a molecular weight of 272.35 g/mol, XLogP of 2.36, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexanediamide;naphthalene is sourced from PubChem (CID 175366237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).