C11H15NO — CID 22103596
4-(2-methylphenyl)butanamide (PubChem CID 22103596) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-(2-methylphenyl)butanamide.
| Compound Name | 4-(2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 22103596 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 4-(2-methylphenyl)butanamide |
| SMILES | Cc1ccccc1CCCC(N)=O |
| InChI | InChI=1S/C11H15NO/c1-9-5-2-3-6-10(9)7-4-8-11(12)13/h2-3,5-6H,4,7-8H2,1H3,(H2,12,13) |
| InChIKey | KKTTYQQTVIGAIP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |