About hexan-2-one;1-methyl-2-propylbenzene
hexan-2-one;1-methyl-2-propylbenzene (PubChem CID 144659527) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is hexan-2-one;1-methyl-2-propylbenzene.
Molecular Properties
| Compound Name | hexan-2-one;1-methyl-2-propylbenzene |
| PubChem CID | 144659527 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | hexan-2-one;1-methyl-2-propylbenzene |
| SMILES | CCCCC(C)=O.CCCc1ccccc1C |
| InChI | InChI=1S/C10H14.C6H12O/c1-3-6-10-8-5-4-7-9(10)2;1-3-4-5-6(2)7/h4-5,7-8H,3,6H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | CQAFYCSWLZJEIV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze hexan-2-one;1-methyl-2-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-one;1-methyl-2-propylbenzene?
The IUPAC name of hexan-2-one;1-methyl-2-propylbenzene (CID 144659527) is hexan-2-one;1-methyl-2-propylbenzene.
What is the SMILES notation for hexan-2-one;1-methyl-2-propylbenzene?
The canonical SMILES for hexan-2-one;1-methyl-2-propylbenzene is CCCCC(C)=O.CCCc1ccccc1C.
What is the InChIKey of hexan-2-one;1-methyl-2-propylbenzene?
The InChIKey is CQAFYCSWLZJEIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C6H12O/c1-3-6-10-8-5-4-7-9(10)2;1-3-4-5-6(2)7/h4-5,7-8H,3,6H2,1-2H3;3-5H2,1-2H3.
What are the key properties of hexan-2-one;1-methyl-2-propylbenzene?
hexan-2-one;1-methyl-2-propylbenzene has a molecular weight of 234.38 g/mol, XLogP of 4.71, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-one;1-methyl-2-propylbenzene is sourced from PubChem (CID 144659527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).