C20H31N — CID 145299288
(Z)-N,7-dimethyl-11-(2-methylphenyl)undec-6-en-5-imine (PubChem CID 145299288) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is (Z)-N,7-dimethyl-11-(2-methylphenyl)undec-6-en-5-imine.
| Compound Name | (Z)-N,7-dimethyl-11-(2-methylphenyl)undec-6-en-5-imine |
|---|---|
| PubChem CID | 145299288 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | (Z)-N,7-dimethyl-11-(2-methylphenyl)undec-6-en-5-imine |
| SMILES | CCCCC(/C=C(/C)CCCCc1ccccc1C)=N\C |
| InChI | InChI=1S/C20H31N/c1-5-6-15-20(21-4)16-17(2)11-7-9-13-19-14-10-8-12-18(19)3/h8,10,12,14,16H,5-7,9,11,13,15H2,1-4H3/b17-16-,21-20+ |
| InChIKey | SGEADPJENWCENO-BKUOKEKNSA-N |
| XLogP | 5.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|