About 1-methyl-2-nonylbenzene;2H-triazole
1-methyl-2-nonylbenzene;2H-triazole (PubChem CID 174954534) has the molecular formula C18H29N3
and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-methyl-2-nonylbenzene;2H-triazole.
Molecular Properties
| Compound Name | 1-methyl-2-nonylbenzene;2H-triazole |
| PubChem CID | 174954534 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 1-methyl-2-nonylbenzene;2H-triazole |
| SMILES | CCCCCCCCCc1ccccc1C.c1cn[nH]n1 |
| InChI | InChI=1S/C16H26.C2H3N3/c1-3-4-5-6-7-8-9-13-16-14-11-10-12-15(16)2;1-2-4-5-3-1/h10-12,14H,3-9,13H2,1-2H3;1-2H,(H,3,4,5) |
| InChIKey | AGLYWXFJQFTDJB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-nonylbenzene;2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-nonylbenzene;2H-triazole?
The IUPAC name of 1-methyl-2-nonylbenzene;2H-triazole (CID 174954534) is 1-methyl-2-nonylbenzene;2H-triazole.
What is the SMILES notation for 1-methyl-2-nonylbenzene;2H-triazole?
The canonical SMILES for 1-methyl-2-nonylbenzene;2H-triazole is CCCCCCCCCc1ccccc1C.c1cn[nH]n1.
What is the InChIKey of 1-methyl-2-nonylbenzene;2H-triazole?
The InChIKey is AGLYWXFJQFTDJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26.C2H3N3/c1-3-4-5-6-7-8-9-13-16-14-11-10-12-15(16)2;1-2-4-5-3-1/h10-12,14H,3-9,13H2,1-2H3;1-2H,(H,3,4,5).
What are the key properties of 1-methyl-2-nonylbenzene;2H-triazole?
1-methyl-2-nonylbenzene;2H-triazole has a molecular weight of 287.45 g/mol, XLogP of 5.09, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-nonylbenzene;2H-triazole is sourced from PubChem (CID 174954534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).