About butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one
butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one (PubChem CID 143890723) has the molecular formula C20H34O2
and a molecular weight of 306.49 g/mol. Its IUPAC name is butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one.
Molecular Properties
| Compound Name | butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one |
| PubChem CID | 143890723 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one |
| SMILES | CCC(C)=O.CCCC(C)=O.CCCc1ccccc1CC |
| InChI | InChI=1S/C11H16.C5H10O.C4H8O/c1-3-7-11-9-6-5-8-10(11)4-2;1-3-4-5(2)6;1-3-4(2)5/h5-6,8-9H,3-4,7H2,1-2H3;3-4H2,1-2H3;3H2,1-2H3 |
| InChIKey | UQFGFGLQIXBCAH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one?
The IUPAC name of butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one (CID 143890723) is butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one.
What is the SMILES notation for butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one?
The canonical SMILES for butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one is CCC(C)=O.CCCC(C)=O.CCCc1ccccc1CC.
What is the InChIKey of butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one?
The InChIKey is UQFGFGLQIXBCAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C5H10O.C4H8O/c1-3-7-11-9-6-5-8-10(11)4-2;1-3-4-5(2)6;1-3-4(2)5/h5-6,8-9H,3-4,7H2,1-2H3;3-4H2,1-2H3;3H2,1-2H3.
What are the key properties of butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one?
butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one has a molecular weight of 306.49 g/mol, XLogP of 5.56, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;1-ethyl-2-propylbenzene;pentan-2-one is sourced from PubChem (CID 143890723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).