About methoxymethanol;1-methyl-2-propylbenzene
methoxymethanol;1-methyl-2-propylbenzene (PubChem CID 145362481) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is methoxymethanol;1-methyl-2-propylbenzene.
Molecular Properties
| Compound Name | methoxymethanol;1-methyl-2-propylbenzene |
| PubChem CID | 145362481 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | methoxymethanol;1-methyl-2-propylbenzene |
| SMILES | CCCc1ccccc1C.COCO |
| InChI | InChI=1S/C10H14.C2H6O2/c1-3-6-10-8-5-4-7-9(10)2;1-4-2-3/h4-5,7-8H,3,6H2,1-2H3;3H,2H2,1H3 |
| InChIKey | YGTIXOOJADXDMQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methoxymethanol;1-methyl-2-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethanol;1-methyl-2-propylbenzene?
The IUPAC name of methoxymethanol;1-methyl-2-propylbenzene (CID 145362481) is methoxymethanol;1-methyl-2-propylbenzene.
What is the SMILES notation for methoxymethanol;1-methyl-2-propylbenzene?
The canonical SMILES for methoxymethanol;1-methyl-2-propylbenzene is CCCc1ccccc1C.COCO.
What is the InChIKey of methoxymethanol;1-methyl-2-propylbenzene?
The InChIKey is YGTIXOOJADXDMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C2H6O2/c1-3-6-10-8-5-4-7-9(10)2;1-4-2-3/h4-5,7-8H,3,6H2,1-2H3;3H,2H2,1H3.
What are the key properties of methoxymethanol;1-methyl-2-propylbenzene?
methoxymethanol;1-methyl-2-propylbenzene has a molecular weight of 196.29 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethanol;1-methyl-2-propylbenzene is sourced from PubChem (CID 145362481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).