About 1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol
1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol (PubChem CID 169131564) has the molecular formula C20H26O
and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol.
Molecular Properties
| Compound Name | 1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol |
| PubChem CID | 169131564 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol |
| SMILES | C=C(C)CO.Cc1ccccc1CCc1ccccc1C |
| InChI | InChI=1S/C16H18.C4H8O/c1-13-7-3-5-9-15(13)11-12-16-10-6-4-8-14(16)2;1-4(2)3-5/h3-10H,11-12H2,1-2H3;5H,1,3H2,2H3 |
| InChIKey | SHCAHVFCEUUKGM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol?
The IUPAC name of 1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol (CID 169131564) is 1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol.
What is the SMILES notation for 1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol?
The canonical SMILES for 1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol is C=C(C)CO.Cc1ccccc1CCc1ccccc1C.
What is the InChIKey of 1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol?
The InChIKey is SHCAHVFCEUUKGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.C4H8O/c1-13-7-3-5-9-15(13)11-12-16-10-6-4-8-14(16)2;1-4(2)3-5/h3-10H,11-12H2,1-2H3;5H,1,3H2,2H3.
What are the key properties of 1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol?
1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol has a molecular weight of 282.43 g/mol, XLogP of 4.64, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-[2-(2-methylphenyl)ethyl]benzene;2-methylprop-2-en-1-ol is sourced from PubChem (CID 169131564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).