C16H24 — CID 176975448
1-(3,6-dimethylhept-6-enyl)-2-methylbenzene (PubChem CID 176975448) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 1-(3,6-dimethylhept-6-enyl)-2-methylbenzene.
| Compound Name | 1-(3,6-dimethylhept-6-enyl)-2-methylbenzene |
|---|---|
| PubChem CID | 176975448 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 1-(3,6-dimethylhept-6-enyl)-2-methylbenzene |
| SMILES | C=C(C)CCC(C)CCc1ccccc1C |
| InChI | InChI=1S/C16H24/c1-13(2)9-10-14(3)11-12-16-8-6-5-7-15(16)4/h5-8,14H,1,9-12H2,2-4H3 |
| InChIKey | ZXIYVZRBCJFDCT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|