C28H38 — CID 176975102
1-ethyl-4-[6-methyl-2-[2-(2-methylphenyl)ethyl]hept-6-enyl]-2-prop-1-en-2-ylbenzene (PubChem CID 176975102) has the molecular formula C28H38 and a molecular weight of 374.61 g/mol. Its IUPAC name is 1-ethyl-4-[6-methyl-2-[2-(2-methylphenyl)ethyl]hept-6-enyl]-2-prop-1-en-2-ylbenzene.
| Compound Name | 1-ethyl-4-[6-methyl-2-[2-(2-methylphenyl)ethyl]hept-6-enyl]-2-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 176975102 |
| Molecular Formula | C28H38 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | 1-ethyl-4-[6-methyl-2-[2-(2-methylphenyl)ethyl]hept-6-enyl]-2-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)CCCC(CCc1ccccc1C)Cc1ccc(CC)c(C(=C)C)c1 |
| InChI | InChI=1S/C28H38/c1-7-26-17-16-25(20-28(26)22(4)5)19-24(13-10-11-21(2)3)15-18-27-14-9-8-12-23(27)6/h8-9,12,14,16-17,20,24H,2,4,7,10-11,13,15,18-19H2,1,3,5-6H3 |
| InChIKey | KOIHSSKYIYWNMG-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|