About ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene
ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene (PubChem CID 142267466) has the molecular formula C25H44
and a molecular weight of 344.63 g/mol. Its IUPAC name is ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene.
Molecular Properties
| Compound Name | ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene |
| PubChem CID | 142267466 |
| Molecular Formula | C25H44 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 344.34 |
| IUPAC Name | ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene |
| SMILES | C=C(C)CCCCCc1ccc(CCCCCCCC)c(C)c1.CC |
| InChI | InChI=1S/C23H38.C2H6/c1-5-6-7-8-9-13-16-23-18-17-22(19-21(23)4)15-12-10-11-14-20(2)3;1-2/h17-19H,2,5-16H2,1,3-4H3;1-2H3 |
| InChIKey | SITOARSZCOTFTP-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene?
The IUPAC name of ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene (CID 142267466) is ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene.
What is the SMILES notation for ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene?
The canonical SMILES for ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene is C=C(C)CCCCCc1ccc(CCCCCCCC)c(C)c1.CC.
What is the InChIKey of ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene?
The InChIKey is SITOARSZCOTFTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H38.C2H6/c1-5-6-7-8-9-13-16-23-18-17-22(19-21(23)4)15-12-10-11-14-20(2)3;1-2/h17-19H,2,5-16H2,1,3-4H3;1-2H3.
What are the key properties of ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene?
ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene has a molecular weight of 344.63 g/mol, XLogP of 8.60, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-4-(6-methylhept-6-enyl)-1-octylbenzene is sourced from PubChem (CID 142267466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).