C24H34O — CID 142206830
1-(4-hexyl-2-methylphenyl)propan-2-one;1,4-xylene (PubChem CID 142206830) has the molecular formula C24H34O and a molecular weight of 338.54 g/mol. Its IUPAC name is 1-(4-hexyl-2-methylphenyl)propan-2-one;1,4-xylene.
| Compound Name | 1-(4-hexyl-2-methylphenyl)propan-2-one;1,4-xylene |
|---|---|
| PubChem CID | 142206830 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 1-(4-hexyl-2-methylphenyl)propan-2-one;1,4-xylene |
| SMILES | CCCCCCc1ccc(CC(C)=O)c(C)c1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C16H24O.C8H10/c1-4-5-6-7-8-15-9-10-16(12-14(3)17)13(2)11-15;1-7-3-5-8(2)6-4-7/h9-11H,4-8,12H2,1-3H3;3-6H,1-2H3 |
| InChIKey | BVSBXMMNLVINPN-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|