About 4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol
4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol (PubChem CID 90733756) has the molecular formula C28H44O2
and a molecular weight of 412.66 g/mol. Its IUPAC name is 4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol.
Molecular Properties
| Compound Name | 4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol |
| PubChem CID | 90733756 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol |
| SMILES | CCCCCCCCCCCCc1ccc(O)c(C)c1.CCc1ccc(C)cc1O |
| InChI | InChI=1S/C19H32O.C9H12O/c1-3-4-5-6-7-8-9-10-11-12-13-18-14-15-19(20)17(2)16-18;1-3-8-5-4-7(2)6-9(8)10/h14-16,20H,3-13H2,1-2H3;4-6,10H,3H2,1-2H3 |
| InChIKey | MPDJGURTALWJHI-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol?
The IUPAC name of 4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol (CID 90733756) is 4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol.
What is the SMILES notation for 4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol?
The canonical SMILES for 4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol is CCCCCCCCCCCCc1ccc(O)c(C)c1.CCc1ccc(C)cc1O.
What is the InChIKey of 4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol?
The InChIKey is MPDJGURTALWJHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O.C9H12O/c1-3-4-5-6-7-8-9-10-11-12-13-18-14-15-19(20)17(2)16-18;1-3-8-5-4-7(2)6-9(8)10/h14-16,20H,3-13H2,1-2H3;4-6,10H,3H2,1-2H3.
What are the key properties of 4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol?
4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol has a molecular weight of 412.66 g/mol, XLogP of 8.43, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-dodecyl-2-methylphenol;2-ethyl-5-methylphenol is sourced from PubChem (CID 90733756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).