About methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol
methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol (PubChem CID 174442186) has the molecular formula C20H36OS
and a molecular weight of 324.57 g/mol. Its IUPAC name is methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol.
Molecular Properties
| Compound Name | methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol |
| PubChem CID | 174442186 |
| Molecular Formula | C20H36OS |
| Molecular Weight | 324.57 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol |
| SMILES | C.C=CCS.CCCCCCCCCc1ccc(O)c(C)c1 |
| InChI | InChI=1S/C16H26O.C3H6S.CH4/c1-3-4-5-6-7-8-9-10-15-11-12-16(17)14(2)13-15;1-2-3-4;/h11-13,17H,3-10H2,1-2H3;2,4H,1,3H2;1H4 |
| InChIKey | ULMJESUVQACTCT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol?
The IUPAC name of methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol (CID 174442186) is methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol.
What is the SMILES notation for methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol?
The canonical SMILES for methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol is C.C=CCS.CCCCCCCCCc1ccc(O)c(C)c1.
What is the InChIKey of methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol?
The InChIKey is ULMJESUVQACTCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O.C3H6S.CH4/c1-3-4-5-6-7-8-9-10-15-11-12-16(17)14(2)13-15;1-2-3-4;/h11-13,17H,3-10H2,1-2H3;2,4H,1,3H2;1H4.
What are the key properties of methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol?
methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol has a molecular weight of 324.57 g/mol, XLogP of 6.73, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methyl-4-nonylphenol;prop-2-ene-1-thiol is sourced from PubChem (CID 174442186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).