About 4-butyl-2-methylphenol;methyl dihydrogen phosphite
4-butyl-2-methylphenol;methyl dihydrogen phosphite (PubChem CID 174305201) has the molecular formula C12H21O4P
and a molecular weight of 260.27 g/mol. Its IUPAC name is 4-butyl-2-methylphenol;methyl dihydrogen phosphite.
Molecular Properties
| Compound Name | 4-butyl-2-methylphenol;methyl dihydrogen phosphite |
| PubChem CID | 174305201 |
| Molecular Formula | C12H21O4P |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-butyl-2-methylphenol;methyl dihydrogen phosphite |
| SMILES | CCCCc1ccc(O)c(C)c1.COP(O)O |
| InChI | InChI=1S/C11H16O.CH5O3P/c1-3-4-5-10-6-7-11(12)9(2)8-10;1-4-5(2)3/h6-8,12H,3-5H2,1-2H3;2-3H,1H3 |
| InChIKey | UBRKUAFWPPBNGP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-2-methylphenol;methyl dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-2-methylphenol;methyl dihydrogen phosphite?
The IUPAC name of 4-butyl-2-methylphenol;methyl dihydrogen phosphite (CID 174305201) is 4-butyl-2-methylphenol;methyl dihydrogen phosphite.
What is the SMILES notation for 4-butyl-2-methylphenol;methyl dihydrogen phosphite?
The canonical SMILES for 4-butyl-2-methylphenol;methyl dihydrogen phosphite is CCCCc1ccc(O)c(C)c1.COP(O)O.
What is the InChIKey of 4-butyl-2-methylphenol;methyl dihydrogen phosphite?
The InChIKey is UBRKUAFWPPBNGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.CH5O3P/c1-3-4-5-10-6-7-11(12)9(2)8-10;1-4-5(2)3/h6-8,12H,3-5H2,1-2H3;2-3H,1H3.
What are the key properties of 4-butyl-2-methylphenol;methyl dihydrogen phosphite?
4-butyl-2-methylphenol;methyl dihydrogen phosphite has a molecular weight of 260.27 g/mol, XLogP of 2.89, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2-methylphenol;methyl dihydrogen phosphite is sourced from PubChem (CID 174305201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).