About CID 140580608
CID 140580608 (PubChem CID 140580608) has the molecular formula C12H19OSi
and a molecular weight of 207.37 g/mol.
Molecular Properties
| Compound Name | CID 140580608 |
| PubChem CID | 140580608 |
| Molecular Formula | C12H19OSi |
| Molecular Weight | 207.37 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | — |
| SMILES | Cc1cc(CCC[Si](C)C)ccc1O |
| InChI | InChI=1S/C12H19OSi/c1-10-9-11(6-7-12(10)13)5-4-8-14(2)3/h6-7,9,13H,4-5,8H2,1-3H3 |
| InChIKey | CJYQOCNKUPJNEN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140580608 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140580608?
The IUPAC name of CID 140580608 (CID 140580608) is not available.
What is the SMILES notation for CID 140580608?
The canonical SMILES for CID 140580608 is Cc1cc(CCC[Si](C)C)ccc1O.
What is the InChIKey of CID 140580608?
The InChIKey is CJYQOCNKUPJNEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19OSi/c1-10-9-11(6-7-12(10)13)5-4-8-14(2)3/h6-7,9,13H,4-5,8H2,1-3H3.
What are the key properties of CID 140580608?
CID 140580608 has a molecular weight of 207.37 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140580608 is sourced from PubChem (CID 140580608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).