About 2-ethyl-5-nonylphenol
2-ethyl-5-nonylphenol (PubChem CID 54394722) has the molecular formula C17H28O
and a molecular weight of 248.41 g/mol. Its IUPAC name is 2-ethyl-5-nonylphenol.
Molecular Properties
| Compound Name | 2-ethyl-5-nonylphenol |
| PubChem CID | 54394722 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 2-ethyl-5-nonylphenol |
| SMILES | CCCCCCCCCc1ccc(CC)c(O)c1 |
| InChI | InChI=1S/C17H28O/c1-3-5-6-7-8-9-10-11-15-12-13-16(4-2)17(18)14-15/h12-14,18H,3-11H2,1-2H3 |
| InChIKey | VJDAESVUJFHCTL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-5-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-nonylphenol?
The IUPAC name of 2-ethyl-5-nonylphenol (CID 54394722) is 2-ethyl-5-nonylphenol.
What is the SMILES notation for 2-ethyl-5-nonylphenol?
The canonical SMILES for 2-ethyl-5-nonylphenol is CCCCCCCCCc1ccc(CC)c(O)c1.
What is the InChIKey of 2-ethyl-5-nonylphenol?
The InChIKey is VJDAESVUJFHCTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O/c1-3-5-6-7-8-9-10-11-15-12-13-16(4-2)17(18)14-15/h12-14,18H,3-11H2,1-2H3.
What are the key properties of 2-ethyl-5-nonylphenol?
2-ethyl-5-nonylphenol has a molecular weight of 248.41 g/mol, XLogP of 5.25, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-nonylphenol is sourced from PubChem (CID 54394722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).