C20H26O — CID 105084187
4-(2-methylphenyl)-1-(2,4,6-trimethylphenyl)butan-2-ol (PubChem CID 105084187) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 4-(2-methylphenyl)-1-(2,4,6-trimethylphenyl)butan-2-ol.
| Compound Name | 4-(2-methylphenyl)-1-(2,4,6-trimethylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 105084187 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 4-(2-methylphenyl)-1-(2,4,6-trimethylphenyl)butan-2-ol |
| SMILES | Cc1cc(C)c(CC(O)CCc2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C20H26O/c1-14-11-16(3)20(17(4)12-14)13-19(21)10-9-18-8-6-5-7-15(18)2/h5-8,11-12,19,21H,9-10,13H2,1-4H3 |
| InChIKey | UJHDJENLHCZZNC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |