C17H28O — CID 114211453
5,5-dimethyl-1-(2,4,6-trimethylphenyl)hexan-2-ol (PubChem CID 114211453) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 5,5-dimethyl-1-(2,4,6-trimethylphenyl)hexan-2-ol.
| Compound Name | 5,5-dimethyl-1-(2,4,6-trimethylphenyl)hexan-2-ol |
|---|---|
| PubChem CID | 114211453 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 5,5-dimethyl-1-(2,4,6-trimethylphenyl)hexan-2-ol |
| SMILES | Cc1cc(C)c(CC(O)CCC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C17H28O/c1-12-9-13(2)16(14(3)10-12)11-15(18)7-8-17(4,5)6/h9-10,15,18H,7-8,11H2,1-6H3 |
| InChIKey | XALBOCLCWURVFE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |