C18H31NO — CID 151069189
6-(aminomethyl)-2-methyl-7-(2,4,6-trimethylphenyl)heptan-2-ol (PubChem CID 151069189) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 6-(aminomethyl)-2-methyl-7-(2,4,6-trimethylphenyl)heptan-2-ol.
| Compound Name | 6-(aminomethyl)-2-methyl-7-(2,4,6-trimethylphenyl)heptan-2-ol |
|---|---|
| PubChem CID | 151069189 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 6-(aminomethyl)-2-methyl-7-(2,4,6-trimethylphenyl)heptan-2-ol |
| SMILES | Cc1cc(C)c(CC(CN)CCCC(C)(C)O)c(C)c1 |
| InChI | InChI=1S/C18H31NO/c1-13-9-14(2)17(15(3)10-13)11-16(12-19)7-6-8-18(4,5)20/h9-10,16,20H,6-8,11-12,19H2,1-5H3 |
| InChIKey | MHTSCBODVLYKHN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |