C21H29N — CID 82141452
2,3-bis(2,4,6-trimethylphenyl)propan-1-amine (PubChem CID 82141452) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is 2,3-bis(2,4,6-trimethylphenyl)propan-1-amine.
| Compound Name | 2,3-bis(2,4,6-trimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 82141452 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 2,3-bis(2,4,6-trimethylphenyl)propan-1-amine |
| SMILES | Cc1cc(C)c(CC(CN)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C21H29N/c1-13-7-15(3)20(16(4)8-13)11-19(12-22)21-17(5)9-14(2)10-18(21)6/h7-10,19H,11-12,22H2,1-6H3 |
| InChIKey | NMJZUYRYWRPRIO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |