C12H18O2 — CID 82112091
2-(2,4,6-trimethylphenyl)propane-1,3-diol (PubChem CID 82112091) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)propane-1,3-diol.
| Compound Name | 2-(2,4,6-trimethylphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 82112091 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)propane-1,3-diol |
| SMILES | Cc1cc(C)c(C(CO)CO)c(C)c1 |
| InChI | InChI=1S/C12H18O2/c1-8-4-9(2)12(10(3)5-8)11(6-13)7-14/h4-5,11,13-14H,6-7H2,1-3H3 |
| InChIKey | OVUHBPIRXMEMPW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |