C12H18O — CID 64989562
2-(2,4,6-trimethylphenyl)propan-1-ol (PubChem CID 64989562) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)propan-1-ol.
| Compound Name | 2-(2,4,6-trimethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 64989562 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)propan-1-ol |
| SMILES | Cc1cc(C)c(C(C)CO)c(C)c1 |
| InChI | InChI=1S/C12H18O/c1-8-5-9(2)12(10(3)6-8)11(4)7-13/h5-6,11,13H,7H2,1-4H3 |
| InChIKey | DBXMHCIEGUDLGH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |