C18H34 — CID 176709600
2-butan-2-yl-1,3,5-trimethylbenzene;ethane;propane (PubChem CID 176709600) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is 2-butan-2-yl-1,3,5-trimethylbenzene;ethane;propane.
| Compound Name | 2-butan-2-yl-1,3,5-trimethylbenzene;ethane;propane |
|---|---|
| PubChem CID | 176709600 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 2-butan-2-yl-1,3,5-trimethylbenzene;ethane;propane |
| SMILES | CC.CCC.CCC(C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C13H20.C3H8.C2H6/c1-6-10(3)13-11(4)7-9(2)8-12(13)5;1-3-2;1-2/h7-8,10H,6H2,1-5H3;3H2,1-2H3;1-2H3 |
| InChIKey | PYFSRMJHPNUYGY-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |