C12H18 — CID 145157940
1-[(2R)-butan-2-yl]-3,5-dimethylbenzene (PubChem CID 145157940) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-3,5-dimethylbenzene.
| Compound Name | 1-[(2R)-butan-2-yl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 145157940 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-3,5-dimethylbenzene |
| SMILES | CC[C@@H](C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C12H18/c1-5-11(4)12-7-9(2)6-10(3)8-12/h6-8,11H,5H2,1-4H3/t11-/m1/s1 |
| InChIKey | JRIIFSPDAWMGAN-LLVKDONJSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |