About 9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene
9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene (PubChem CID 123187495) has the molecular formula C37H42
and a molecular weight of 486.74 g/mol. Its IUPAC name is 9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene.
Molecular Properties
| Compound Name | 9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene |
| PubChem CID | 123187495 |
| Molecular Formula | C37H42 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | 9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene |
| SMILES | CCC(C)c1cc(C)cc(C2(c3cc(C)cc(C(C)CC)c3)c3cc(C)ccc3-c3ccc(C)cc32)c1 |
| InChI | InChI=1S/C37H42/c1-9-27(7)29-15-25(5)17-31(21-29)37(32-18-26(6)16-30(22-32)28(8)10-2)35-19-23(3)11-13-33(35)34-14-12-24(4)20-36(34)37/h11-22,27-28H,9-10H2,1-8H3 |
| InChIKey | CZSAZOUSQUHMJP-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene?
The IUPAC name of 9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene (CID 123187495) is 9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene.
What is the SMILES notation for 9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene?
The canonical SMILES for 9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene is CCC(C)c1cc(C)cc(C2(c3cc(C)cc(C(C)CC)c3)c3cc(C)ccc3-c3ccc(C)cc32)c1.
What is the InChIKey of 9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene?
The InChIKey is CZSAZOUSQUHMJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H42/c1-9-27(7)29-15-25(5)17-31(21-29)37(32-18-26(6)16-30(22-32)28(8)10-2)35-19-23(3)11-13-33(35)34-14-12-24(4)20-36(34)37/h11-22,27-28H,9-10H2,1-8H3.
What are the key properties of 9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene?
9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene has a molecular weight of 486.74 g/mol, XLogP of 10.31, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-bis(3-butan-2-yl-5-methylphenyl)-2,7-dimethylfluorene is sourced from PubChem (CID 123187495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).