C35H38 — CID 123424959
9,9-bis(3,5-diethylphenyl)-2,7-dimethylfluorene (PubChem CID 123424959) has the molecular formula C35H38 and a molecular weight of 458.69 g/mol. Its IUPAC name is 9,9-bis(3,5-diethylphenyl)-2,7-dimethylfluorene.
| Compound Name | 9,9-bis(3,5-diethylphenyl)-2,7-dimethylfluorene |
|---|---|
| PubChem CID | 123424959 |
| Molecular Formula | C35H38 |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | 9,9-bis(3,5-diethylphenyl)-2,7-dimethylfluorene |
| SMILES | CCc1cc(CC)cc(C2(c3cc(CC)cc(CC)c3)c3cc(C)ccc3-c3ccc(C)cc32)c1 |
| InChI | InChI=1S/C35H38/c1-7-25-17-26(8-2)20-29(19-25)35(30-21-27(9-3)18-28(10-4)22-30)33-15-23(5)11-13-31(33)32-14-12-24(6)16-34(32)35/h11-22H,7-10H2,1-6H3 |
| InChIKey | VXASCUOITRKAKC-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |