C18H20 — CID 59167125
2-ethyl-7,9,9-trimethylfluorene (PubChem CID 59167125) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-ethyl-7,9,9-trimethylfluorene.
| Compound Name | 2-ethyl-7,9,9-trimethylfluorene |
|---|---|
| PubChem CID | 59167125 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-ethyl-7,9,9-trimethylfluorene |
| SMILES | CCc1ccc2c(c1)C(C)(C)c1cc(C)ccc1-2 |
| InChI | InChI=1S/C18H20/c1-5-13-7-9-15-14-8-6-12(2)10-16(14)18(3,4)17(15)11-13/h6-11H,5H2,1-4H3 |
| InChIKey | YONKNJCABJTNMT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |