C17H16F2 — CID 67522725
2,7-diethyl-9,9-difluorofluorene (PubChem CID 67522725) has the molecular formula C17H16F2 and a molecular weight of 258.31 g/mol. Its IUPAC name is 2,7-diethyl-9,9-difluorofluorene.
| Compound Name | 2,7-diethyl-9,9-difluorofluorene |
|---|---|
| PubChem CID | 67522725 |
| Molecular Formula | C17H16F2 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2,7-diethyl-9,9-difluorofluorene |
| SMILES | CCc1ccc2c(c1)C(F)(F)c1cc(CC)ccc1-2 |
| InChI | InChI=1S/C17H16F2/c1-3-11-5-7-13-14-8-6-12(4-2)10-16(14)17(18,19)15(13)9-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | GZKIIDDJYWRYAB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |