C23H23NO — CID 170093919
[4-[(7,9,9-trimethylfluoren-2-yl)amino]phenyl]methanol (PubChem CID 170093919) has the molecular formula C23H23NO and a molecular weight of 329.44 g/mol. Its IUPAC name is [4-[(7,9,9-trimethylfluoren-2-yl)amino]phenyl]methanol.
| Compound Name | [4-[(7,9,9-trimethylfluoren-2-yl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 170093919 |
| Molecular Formula | C23H23NO |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | [4-[(7,9,9-trimethylfluoren-2-yl)amino]phenyl]methanol |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(Nc3ccc(CO)cc3)ccc1-2 |
| InChI | InChI=1S/C23H23NO/c1-15-4-10-19-20-11-9-18(13-22(20)23(2,3)21(19)12-15)24-17-7-5-16(14-25)6-8-17/h4-13,24-25H,14H2,1-3H3 |
| InChIKey | VNGPUGUFTAIQCV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |