C23H21N — CID 163509163
N-(4-ethenylphenyl)-9,9-dimethylfluoren-2-amine (PubChem CID 163509163) has the molecular formula C23H21N and a molecular weight of 311.43 g/mol. Its IUPAC name is N-(4-ethenylphenyl)-9,9-dimethylfluoren-2-amine.
| Compound Name | N-(4-ethenylphenyl)-9,9-dimethylfluoren-2-amine |
|---|---|
| PubChem CID | 163509163 |
| Molecular Formula | C23H21N |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-(4-ethenylphenyl)-9,9-dimethylfluoren-2-amine |
| SMILES | C=Cc1ccc(Nc2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C23H21N/c1-4-16-9-11-17(12-10-16)24-18-13-14-20-19-7-5-6-8-21(19)23(2,3)22(20)15-18/h4-15,24H,1H2,2-3H3 |
| InChIKey | DBERXHXFPNMUNW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |