C24H27NSi — CID 123399255
9,9-dimethyl-N-(4-trimethylsilylphenyl)fluoren-2-amine (PubChem CID 123399255) has the molecular formula C24H27NSi and a molecular weight of 357.57 g/mol. Its IUPAC name is 9,9-dimethyl-N-(4-trimethylsilylphenyl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-(4-trimethylsilylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 123399255 |
| Molecular Formula | C24H27NSi |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 9,9-dimethyl-N-(4-trimethylsilylphenyl)fluoren-2-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(Nc3ccc([Si](C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C24H27NSi/c1-24(2)22-9-7-6-8-20(22)21-15-12-18(16-23(21)24)25-17-10-13-19(14-11-17)26(3,4)5/h6-16,25H,1-5H3 |
| InChIKey | LRXRUBJAIMEUPG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|