About CID 144628230
CID 144628230 (PubChem CID 144628230) has the molecular formula C27H18B5N
and a molecular weight of 410.51 g/mol.
Molecular Properties
| Compound Name | CID 144628230 |
| PubChem CID | 144628230 |
| Molecular Formula | C27H18B5N |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2ccc(Nc3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)c([B])c1[B] |
| InChI | InChI=1S/C27H18B5N/c1-27(2)19-6-4-3-5-17(19)18-12-11-16(13-20(18)27)33-15-9-7-14(8-10-15)21-22(28)24(30)26(32)25(31)23(21)29/h3-13,33H,1-2H3 |
| InChIKey | QHIDLEFSPMUQHD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 144628230 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144628230?
The IUPAC name of CID 144628230 (CID 144628230) is not available.
What is the SMILES notation for CID 144628230?
The canonical SMILES for CID 144628230 is [B]c1c([B])c([B])c(-c2ccc(Nc3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)c([B])c1[B].
What is the InChIKey of CID 144628230?
The InChIKey is QHIDLEFSPMUQHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18B5N/c1-27(2)19-6-4-3-5-17(19)18-12-11-16(13-20(18)27)33-15-9-7-14(8-10-15)21-22(28)24(30)26(32)25(31)23(21)29/h3-13,33H,1-2H3.
What are the key properties of CID 144628230?
CID 144628230 has a molecular weight of 410.51 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144628230 is sourced from PubChem (CID 144628230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).