C27H23N — CID 155619972
N-(4-phenylphenyl)-9,9-bis(trideuteriomethyl)fluoren-2-amine (PubChem CID 155619972) has the molecular formula C27H23N and a molecular weight of 367.52 g/mol. Its IUPAC name is N-(4-phenylphenyl)-9,9-bis(trideuteriomethyl)fluoren-2-amine.
| Compound Name | N-(4-phenylphenyl)-9,9-bis(trideuteriomethyl)fluoren-2-amine |
|---|---|
| PubChem CID | 155619972 |
| Molecular Formula | C27H23N |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | N-(4-phenylphenyl)-9,9-bis(trideuteriomethyl)fluoren-2-amine |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])c2ccccc2-c2ccc(Nc3ccc(-c4ccccc4)cc3)cc21 |
| InChI | InChI=1S/C27H23N/c1-27(2)25-11-7-6-10-23(25)24-17-16-22(18-26(24)27)28-21-14-12-20(13-15-21)19-8-4-3-5-9-19/h3-18,28H,1-2H3/i1D3,2D3 |
| InChIKey | QRMLAMCEPKEKHS-WFGJKAKNSA-N |
| XLogP | 7.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |