C46H47N — CID 143972766
4-(9,9-dimethylfluoren-2-yl)-N-[4-(9,9-dimethylfluoren-2-yl)phenyl]aniline;ethane (PubChem CID 143972766) has the molecular formula C46H47N and a molecular weight of 613.89 g/mol. Its IUPAC name is 4-(9,9-dimethylfluoren-2-yl)-N-[4-(9,9-dimethylfluoren-2-yl)phenyl]aniline;ethane.
| Compound Name | 4-(9,9-dimethylfluoren-2-yl)-N-[4-(9,9-dimethylfluoren-2-yl)phenyl]aniline;ethane |
|---|---|
| PubChem CID | 143972766 |
| Molecular Formula | C46H47N |
| Molecular Weight | 613.89 g/mol |
| Exact Mass | 613.37 |
| IUPAC Name | 4-(9,9-dimethylfluoren-2-yl)-N-[4-(9,9-dimethylfluoren-2-yl)phenyl]aniline;ethane |
| SMILES | CC.CC.CC1(C)c2ccccc2-c2ccc(-c3ccc(Nc4ccc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc4)cc3)cc21 |
| InChI | InChI=1S/C42H35N.2C2H6/c1-41(2)37-11-7-5-9-33(37)35-23-17-29(25-39(35)41)27-13-19-31(20-14-27)43-32-21-15-28(16-22-32)30-18-24-36-34-10-6-8-12-38(34)42(3,4)40(36)26-30;2*1-2/h5-26,43H,1-4H3;2*1-2H3 |
| InChIKey | BRJFGGCYRLVSNZ-UHFFFAOYSA-N |
| XLogP | 13.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.89 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |