C47H60O4 — CID 58544758
2',7'-dimethyl-2,3,6,7-tetrakis(2-methylbutoxy)-9,9'-spirobi[fluorene] (PubChem CID 58544758) has the molecular formula C47H60O4 and a molecular weight of 688.99 g/mol. Its IUPAC name is 2',7'-dimethyl-2,3,6,7-tetrakis(2-methylbutoxy)-9,9'-spirobi[fluorene].
| Compound Name | 2',7'-dimethyl-2,3,6,7-tetrakis(2-methylbutoxy)-9,9'-spirobi[fluorene] |
|---|---|
| PubChem CID | 58544758 |
| Molecular Formula | C47H60O4 |
| Molecular Weight | 688.99 g/mol |
| Exact Mass | 688.45 |
| IUPAC Name | 2',7'-dimethyl-2,3,6,7-tetrakis(2-methylbutoxy)-9,9'-spirobi[fluorene] |
| SMILES | CCC(C)COc1cc2c(cc1OCC(C)CC)C1(c3cc(C)ccc3-c3ccc(C)cc31)c1cc(OCC(C)CC)c(OCC(C)CC)cc1-2 |
| InChI | InChI=1S/C47H60O4/c1-11-29(5)25-48-43-21-37-38-22-44(49-26-30(6)12-2)46(51-28-32(8)14-4)24-42(38)47(41(37)23-45(43)50-27-31(7)13-3)39-19-33(9)15-17-35(39)36-18-16-34(10)20-40(36)47/h15-24,29-32H,11-14,25-28H2,1-10H3 |
| InChIKey | KQCQGHAMIVMUBU-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.99 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |