C37H40B2O2 — CID 89263922
CID 89263922 (PubChem CID 89263922) has the molecular formula C37H40B2O2 and a molecular weight of 538.35 g/mol.
| Compound Name | CID 89263922 |
|---|---|
| PubChem CID | 89263922 |
| Molecular Formula | C37H40B2O2 |
| Molecular Weight | 538.35 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C(c1ccc(OCC(C)CC)c(OCC(C)CC)c1)(c1cc(C)ccc1C)c1cc([B])ccc1-2 |
| InChI | InChI=1S/C37H40B2O2/c1-7-23(3)21-40-35-16-11-27(18-36(35)41-22-24(4)8-2)37(32-17-25(5)9-10-26(32)6)33-19-28(38)12-14-30(33)31-15-13-29(39)20-34(31)37/h9-20,23-24H,7-8,21-22H2,1-6H3 |
| InChIKey | HSLBKPWBNBBPJB-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.35 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|