C58H72B2O6 — CID 102482421
2-[9-[3,4-bis(2-methylbutoxy)phenyl]-9-(9,9-dihexylfluoren-2-yl)-7-(1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane (PubChem CID 102482421) has the molecular formula C58H72B2O6 and a molecular weight of 886.83 g/mol. Its IUPAC name is 2-[9-[3,4-bis(2-methylbutoxy)phenyl]-9-(9,9-dihexylfluoren-2-yl)-7-(1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 2-[9-[3,4-bis(2-methylbutoxy)phenyl]-9-(9,9-dihexylfluoren-2-yl)-7-(1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102482421 |
| Molecular Formula | C58H72B2O6 |
| Molecular Weight | 886.83 g/mol |
| Exact Mass | 886.55 |
| IUPAC Name | 2-[9-[3,4-bis(2-methylbutoxy)phenyl]-9-(9,9-dihexylfluoren-2-yl)-7-(1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane |
| SMILES | CCCCCCC1(CCCCCC)c2ccccc2-c2ccc(C3(c4ccc(OCC(C)CC)c(OCC(C)CC)c4)c4cc(B5OCCO5)ccc4-c4ccc(B5OCCO5)cc43)cc21 |
| InChI | InChI=1S/C58H72B2O6/c1-7-11-13-17-29-57(30-18-14-12-8-2)51-20-16-15-19-47(51)48-25-21-43(35-52(48)57)58(44-22-28-55(61-39-41(5)9-3)56(36-44)62-40-42(6)10-4)53-37-45(59-63-31-32-64-59)23-26-49(53)50-27-24-46(38-54(50)58)60-65-33-34-66-60/h15-16,19-28,35-38,41-42H,7-14,17-18,29-34,39-40H2,1-6H3 |
| InChIKey | GGUZJTRZHWPUJW-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.83 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|