C33H36 — CID 158619451
2,2',3',6',7,7'-hexamethyl-9,9'-spirobi[fluorene];methane (PubChem CID 158619451) has the molecular formula C33H36 and a molecular weight of 432.65 g/mol. Its IUPAC name is 2,2',3',6',7,7'-hexamethyl-9,9'-spirobi[fluorene];methane.
| Compound Name | 2,2',3',6',7,7'-hexamethyl-9,9'-spirobi[fluorene];methane |
|---|---|
| PubChem CID | 158619451 |
| Molecular Formula | C33H36 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 2,2',3',6',7,7'-hexamethyl-9,9'-spirobi[fluorene];methane |
| SMILES | C.C.Cc1ccc2c(c1)C1(c3cc(C)ccc3-2)c2cc(C)c(C)cc2-c2cc(C)c(C)cc21 |
| InChI | InChI=1S/C31H28.2CH4/c1-17-7-9-23-24-10-8-18(2)12-28(24)31(27(23)11-17)29-15-21(5)19(3)13-25(29)26-14-20(4)22(6)16-30(26)31;;/h7-16H,1-6H3;2*1H4 |
| InChIKey | HXUVHAVFJPNKIH-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |