C11H17N — CID 79003874
2-(3,5-dimethylphenyl)propan-1-amine (PubChem CID 79003874) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)propan-1-amine.
| Compound Name | 2-(3,5-dimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 79003874 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2-(3,5-dimethylphenyl)propan-1-amine |
| SMILES | Cc1cc(C)cc(C(C)CN)c1 |
| InChI | InChI=1S/C11H17N/c1-8-4-9(2)6-11(5-8)10(3)7-12/h4-6,10H,7,12H2,1-3H3 |
| InChIKey | WZTWOJDBDHKFNQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |