C12H19NO — CID 65190666
3-amino-1-(3,5-dimethylphenyl)-2-methylpropan-1-ol (PubChem CID 65190666) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-amino-1-(3,5-dimethylphenyl)-2-methylpropan-1-ol.
| Compound Name | 3-amino-1-(3,5-dimethylphenyl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 65190666 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-amino-1-(3,5-dimethylphenyl)-2-methylpropan-1-ol |
| SMILES | Cc1cc(C)cc(C(O)C(C)CN)c1 |
| InChI | InChI=1S/C12H19NO/c1-8-4-9(2)6-11(5-8)12(14)10(3)7-13/h4-6,10,12,14H,7,13H2,1-3H3 |
| InChIKey | FBBJYWNAHBWMBJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |