C9H15NO2 — CID 165448561
3-amino-2-methyl-1-(4-methylfuran-2-yl)propan-1-ol (PubChem CID 165448561) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 3-amino-2-methyl-1-(4-methylfuran-2-yl)propan-1-ol.
| Compound Name | 3-amino-2-methyl-1-(4-methylfuran-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 165448561 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 3-amino-2-methyl-1-(4-methylfuran-2-yl)propan-1-ol |
| SMILES | Cc1coc(C(O)C(C)CN)c1 |
| InChI | InChI=1S/C9H15NO2/c1-6-3-8(12-5-6)9(11)7(2)4-10/h3,5,7,9,11H,4,10H2,1-2H3 |
| InChIKey | XSPZQWPHYZVPMZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |