C10H13Br2NO — CID 107955003
3-amino-1-(2,4-dibromophenyl)-2-methylpropan-1-ol (PubChem CID 107955003) has the molecular formula C10H13Br2NO and a molecular weight of 323.03 g/mol. Its IUPAC name is 3-amino-1-(2,4-dibromophenyl)-2-methylpropan-1-ol.
| Compound Name | 3-amino-1-(2,4-dibromophenyl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 107955003 |
| Molecular Formula | C10H13Br2NO |
| Molecular Weight | 323.03 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | 3-amino-1-(2,4-dibromophenyl)-2-methylpropan-1-ol |
| SMILES | CC(CN)C(O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H13Br2NO/c1-6(5-13)10(14)8-3-2-7(11)4-9(8)12/h2-4,6,10,14H,5,13H2,1H3 |
| InChIKey | XBZSBIHNLIXMBJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.03 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |