C12H17BrO2 — CID 171891556
4-bromo-1-(3,5-dimethylphenyl)butane-1,2-diol (PubChem CID 171891556) has the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. Its IUPAC name is 4-bromo-1-(3,5-dimethylphenyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(3,5-dimethylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171891556 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 4-bromo-1-(3,5-dimethylphenyl)butane-1,2-diol |
| SMILES | Cc1cc(C)cc(C(O)C(O)CCBr)c1 |
| InChI | InChI=1S/C12H17BrO2/c1-8-5-9(2)7-10(6-8)12(15)11(14)3-4-13/h5-7,11-12,14-15H,3-4H2,1-2H3 |
| InChIKey | UKIMYXMAXLJEAO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|