C14H24 — CID 162176469
2-methylbutane;1,3,5-trimethylbenzene (PubChem CID 162176469) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 2-methylbutane;1,3,5-trimethylbenzene.
| Compound Name | 2-methylbutane;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 162176469 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 2-methylbutane;1,3,5-trimethylbenzene |
| SMILES | CCC(C)C.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C9H12.C5H12/c1-7-4-8(2)6-9(3)5-7;1-4-5(2)3/h4-6H,1-3H3;5H,4H2,1-3H3 |
| InChIKey | ZOLPVXLJLYHPOJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |