C11H15ClO2 — CID 117306028
4-chloro-3-(1-hydroxypropan-2-yl)-2,6-dimethylphenol (PubChem CID 117306028) has the molecular formula C11H15ClO2 and a molecular weight of 214.69 g/mol. Its IUPAC name is 4-chloro-3-(1-hydroxypropan-2-yl)-2,6-dimethylphenol.
| Compound Name | 4-chloro-3-(1-hydroxypropan-2-yl)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 117306028 |
| Molecular Formula | C11H15ClO2 |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 4-chloro-3-(1-hydroxypropan-2-yl)-2,6-dimethylphenol |
| SMILES | Cc1cc(Cl)c(C(C)CO)c(C)c1O |
| InChI | InChI=1S/C11H15ClO2/c1-6-4-9(12)10(7(2)5-13)8(3)11(6)14/h4,7,13-14H,5H2,1-3H3 |
| InChIKey | QOPSTIKEHBQXHF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |