C12H15ClO3 — CID 84801808
2-(5-chloro-2-hydroxy-3,6-dimethylphenyl)butanoic acid (PubChem CID 84801808) has the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. Its IUPAC name is 2-(5-chloro-2-hydroxy-3,6-dimethylphenyl)butanoic acid.
| Compound Name | 2-(5-chloro-2-hydroxy-3,6-dimethylphenyl)butanoic acid |
|---|---|
| PubChem CID | 84801808 |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-(5-chloro-2-hydroxy-3,6-dimethylphenyl)butanoic acid |
| SMILES | CCC(C(=O)O)c1c(C)c(Cl)cc(C)c1O |
| InChI | InChI=1S/C12H15ClO3/c1-4-8(12(15)16)10-7(3)9(13)5-6(2)11(10)14/h5,8,14H,4H2,1-3H3,(H,15,16) |
| InChIKey | NFMQRZZFWHAROC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |