2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid

C11H13ClO4 — CID 84802674

IUPAC2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid
SMILESCCC(C(=O)O)c1cc(C)c(O)c(Cl)c1O
InChIInChI=1S/C11H13ClO4/c1-3-6(11(15)16)7-4-5(2)9(13)8(12)10(7)14/h4,6,13-14H,3H2,1-2H3,(H,15,16)
InChIKeyJSDUMJGUKHYTBB-UHFFFAOYSA-N
MW244.67 g/mol
LogP2.64
Rot. Bonds3

About 2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid

2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid (PubChem CID 84802674) has the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. Its IUPAC name is 2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid.

Molecular Properties

Compound Name2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid
PubChem CID84802674
Molecular FormulaC11H13ClO4
Molecular Weight244.67 g/mol
Exact Mass244.05
IUPAC Name2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid
SMILESCCC(C(=O)O)c1cc(C)c(O)c(Cl)c1O
InChIInChI=1S/C11H13ClO4/c1-3-6(11(15)16)7-4-5(2)9(13)8(12)10(7)14/h4,6,13-14H,3H2,1-2H3,(H,15,16)
InChIKeyJSDUMJGUKHYTBB-UHFFFAOYSA-N
XLogP2.64
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.67
LogP ≤ 52.64
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid?
The IUPAC name of 2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid (CID 84802674) is 2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid.
What is the SMILES notation for 2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid?
The canonical SMILES for 2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid is CCC(C(=O)O)c1cc(C)c(O)c(Cl)c1O.
What is the InChIKey of 2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid?
The InChIKey is JSDUMJGUKHYTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO4/c1-3-6(11(15)16)7-4-5(2)9(13)8(12)10(7)14/h4,6,13-14H,3H2,1-2H3,(H,15,16).
What are the key properties of 2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid?
2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid has a molecular weight of 244.67 g/mol, XLogP of 2.64, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-2,4-dihydroxy-5-methylphenyl)butanoic acid is sourced from PubChem (CID 84802674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).